C19H30O2Si — CID 101106032
(2R,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylcyclohexan-1-one (PubChem CID 101106032) has the molecular formula C19H30O2Si and a molecular weight of 318.53 g/mol. Its IUPAC name is (2R,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylcyclohexan-1-one.
| Compound Name | (2R,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 101106032 |
| Molecular Formula | C19H30O2Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (2R,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylcyclohexan-1-one |
| SMILES | C[C@H]1C(=O)C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H30O2Si/c1-14-17(15-10-8-7-9-11-15)12-16(13-18(14)20)21-22(5,6)19(2,3)4/h7-11,14,16-17H,12-13H2,1-6H3/t14-,16-,17-/m1/s1 |
| InChIKey | QKDDWAHKQNRIGA-DJIMGWMZSA-N |
| XLogP | 5.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|