C16H33NO2Si — CID 91080488
(4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(diethylaminomethyl)cyclopentan-1-one (PubChem CID 91080488) has the molecular formula C16H33NO2Si and a molecular weight of 299.53 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(diethylaminomethyl)cyclopentan-1-one.
| Compound Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(diethylaminomethyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 91080488 |
| Molecular Formula | C16H33NO2Si |
| Molecular Weight | 299.53 g/mol |
| Exact Mass | 299.23 |
| IUPAC Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(diethylaminomethyl)cyclopentan-1-one |
| SMILES | CCN(CC)CC1C[C@H](O[Si](C)(C)C(C)(C)C)CC1=O |
| InChI | InChI=1S/C16H33NO2Si/c1-8-17(9-2)12-13-10-14(11-15(13)18)19-20(6,7)16(3,4)5/h13-14H,8-12H2,1-7H3/t13?,14-/m0/s1 |
| InChIKey | NTCQXDKGUXVOKZ-KZUDCZAMSA-N |
| XLogP | 3.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|