C19H40O4Si2 — CID 11047381
(2S,4R,6R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-(hydroxymethyl)cyclohexan-1-one (PubChem CID 11047381) has the molecular formula C19H40O4Si2 and a molecular weight of 388.70 g/mol. Its IUPAC name is (2S,4R,6R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-(hydroxymethyl)cyclohexan-1-one.
| Compound Name | (2S,4R,6R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-(hydroxymethyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 11047381 |
| Molecular Formula | C19H40O4Si2 |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (2S,4R,6R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-(hydroxymethyl)cyclohexan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H](CO)C(=O)[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C19H40O4Si2/c1-18(2,3)24(7,8)22-15-11-14(13-20)17(21)16(12-15)23-25(9,10)19(4,5)6/h14-16,20H,11-13H2,1-10H3/t14-,15-,16+/m1/s1 |
| InChIKey | YFTWEGPRQYPOFU-OAGGEKHMSA-N |
| XLogP | 4.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|