C12H27NO2Si — CID 145222779
[(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-methylpyrrolidin-2-yl]methanol (PubChem CID 145222779) has the molecular formula C12H27NO2Si and a molecular weight of 245.44 g/mol. Its IUPAC name is [(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-methylpyrrolidin-2-yl]methanol.
| Compound Name | [(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-methylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 145222779 |
| Molecular Formula | C12H27NO2Si |
| Molecular Weight | 245.44 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | [(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-methylpyrrolidin-2-yl]methanol |
| SMILES | CN1C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1CO |
| InChI | InChI=1S/C12H27NO2Si/c1-12(2,3)16(5,6)15-11-7-10(9-14)13(4)8-11/h10-11,14H,7-9H2,1-6H3/t10-,11-/m0/s1 |
| InChIKey | FJBJLYATUZIDDF-QWRGUYRKSA-N |
| XLogP | 2.07 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|