C13H27NO4Si — CID 66844757
(2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)piperidine-1-carboxylic acid (PubChem CID 66844757) has the molecular formula C13H27NO4Si and a molecular weight of 289.45 g/mol. Its IUPAC name is (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)piperidine-1-carboxylic acid.
| Compound Name | (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66844757 |
| Molecular Formula | C13H27NO4Si |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)piperidine-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@H](CO)N(C(=O)O)C1 |
| InChI | InChI=1S/C13H27NO4Si/c1-13(2,3)19(4,5)18-11-7-6-10(9-15)14(8-11)12(16)17/h10-11,15H,6-9H2,1-5H3,(H,16,17)/t10-,11-/m1/s1 |
| InChIKey | BIPZPGPPBRZKFQ-GHMZBOCLSA-N |
| XLogP | 2.51 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|