C21H35NO5Si — CID 68992350
(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-phenoxypropoxymethyl)pyrrolidine-1-carboxylic acid (PubChem CID 68992350) has the molecular formula C21H35NO5Si and a molecular weight of 409.60 g/mol. Its IUPAC name is (2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-phenoxypropoxymethyl)pyrrolidine-1-carboxylic acid.
| Compound Name | (2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-phenoxypropoxymethyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68992350 |
| Molecular Formula | C21H35NO5Si |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | (2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-phenoxypropoxymethyl)pyrrolidine-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](COCCCOc2ccccc2)N(C(=O)O)C1 |
| InChI | InChI=1S/C21H35NO5Si/c1-21(2,3)28(4,5)27-19-14-17(22(15-19)20(23)24)16-25-12-9-13-26-18-10-7-6-8-11-18/h6-8,10-11,17,19H,9,12-16H2,1-5H3,(H,23,24)/t17-,19+/m1/s1 |
| InChIKey | ANACZPCTXSKXSZ-MJGOQNOKSA-N |
| XLogP | 4.61 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|