C13H25NO5Si — CID 90782508
(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylic acid (PubChem CID 90782508) has the molecular formula C13H25NO5Si and a molecular weight of 303.43 g/mol. Its IUPAC name is (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylic acid.
| Compound Name | (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 90782508 |
| Molecular Formula | C13H25NO5Si |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCN(C(=O)O)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C13H25NO5Si/c1-13(2,3)20(4,5)19-9-6-7-14(12(17)18)10(8-9)11(15)16/h9-10H,6-8H2,1-5H3,(H,15,16)(H,17,18)/t9-,10+/m1/s1 |
| InChIKey | GBNOWBXKRDRSIB-ZJUUUORDSA-N |
| XLogP | 2.60 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|