C17H33NO4Si — CID 170939046
tert-butyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-formylpiperidine-1-carboxylate (PubChem CID 170939046) has the molecular formula C17H33NO4Si and a molecular weight of 343.54 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-formylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-formylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 170939046 |
| Molecular Formula | C17H33NO4Si |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | tert-butyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-formylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C=O |
| InChI | InChI=1S/C17H33NO4Si/c1-16(2,3)21-15(20)18-10-9-14(11-13(18)12-19)22-23(7,8)17(4,5)6/h12-14H,9-11H2,1-8H3/t13-,14-/m0/s1 |
| InChIKey | GPOYMEYCJJKXFS-KBPBESRZSA-N |
| XLogP | 3.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|