C20H37NO4Si — CID 174050124
tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-6-formyl-7-azaspiro[3.5]nonane-7-carboxylate (PubChem CID 174050124) has the molecular formula C20H37NO4Si and a molecular weight of 383.61 g/mol. Its IUPAC name is tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-6-formyl-7-azaspiro[3.5]nonane-7-carboxylate.
| Compound Name | tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-6-formyl-7-azaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 174050124 |
| Molecular Formula | C20H37NO4Si |
| Molecular Weight | 383.61 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-6-formyl-7-azaspiro[3.5]nonane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC(O[Si](C)(C)C(C)(C)C)C2)CC1C=O |
| InChI | InChI=1S/C20H37NO4Si/c1-18(2,3)24-17(23)21-10-9-20(11-15(21)14-22)12-16(13-20)25-26(7,8)19(4,5)6/h14-16H,9-13H2,1-8H3 |
| InChIKey | UAWBQWBSFBRKHG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|