C10H15Cl2NO3 — CID 141300395
tert-butyl (2S)-4,4-dichloro-2-formylpyrrolidine-1-carboxylate (PubChem CID 141300395) has the molecular formula C10H15Cl2NO3 and a molecular weight of 268.14 g/mol. Its IUPAC name is tert-butyl (2S)-4,4-dichloro-2-formylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4,4-dichloro-2-formylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 141300395 |
| Molecular Formula | C10H15Cl2NO3 |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | tert-butyl (2S)-4,4-dichloro-2-formylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Cl)(Cl)C[C@H]1C=O |
| InChI | InChI=1S/C10H15Cl2NO3/c1-9(2,3)16-8(15)13-6-10(11,12)4-7(13)5-14/h5,7H,4,6H2,1-3H3/t7-/m0/s1 |
| InChIKey | UQDCHVXNYCQYQR-ZETCQYMHSA-N |
| XLogP | 2.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|