About tert-butyl 2-formylpiperidine-1-carboxylate;ethane
tert-butyl 2-formylpiperidine-1-carboxylate;ethane (PubChem CID 145071320) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is tert-butyl 2-formylpiperidine-1-carboxylate;ethane.
Molecular Properties
| Compound Name | tert-butyl 2-formylpiperidine-1-carboxylate;ethane |
| PubChem CID | 145071320 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | tert-butyl 2-formylpiperidine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCCCC1C=O |
| InChI | InChI=1S/C11H19NO3.C2H6/c1-11(2,3)15-10(14)12-7-5-4-6-9(12)8-13;1-2/h8-9H,4-7H2,1-3H3;1-2H3 |
| InChIKey | MQTABUOWNTUDIP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-formylpiperidine-1-carboxylate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-formylpiperidine-1-carboxylate;ethane?
The IUPAC name of tert-butyl 2-formylpiperidine-1-carboxylate;ethane (CID 145071320) is tert-butyl 2-formylpiperidine-1-carboxylate;ethane.
What is the SMILES notation for tert-butyl 2-formylpiperidine-1-carboxylate;ethane?
The canonical SMILES for tert-butyl 2-formylpiperidine-1-carboxylate;ethane is CC.CC(C)(C)OC(=O)N1CCCCC1C=O.
What is the InChIKey of tert-butyl 2-formylpiperidine-1-carboxylate;ethane?
The InChIKey is MQTABUOWNTUDIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3.C2H6/c1-11(2,3)15-10(14)12-7-5-4-6-9(12)8-13;1-2/h8-9H,4-7H2,1-3H3;1-2H3.
What are the key properties of tert-butyl 2-formylpiperidine-1-carboxylate;ethane?
tert-butyl 2-formylpiperidine-1-carboxylate;ethane has a molecular weight of 243.35 g/mol, XLogP of 3.00, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-formylpiperidine-1-carboxylate;ethane is sourced from PubChem (CID 145071320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).