C11H22ClN3O2 — CID 171369565
(PubChem CID 171369565) has the molecular formula C11H22ClN3O2 and a molecular weight of 263.77 g/mol.
| Compound Name | |
|---|---|
| PubChem CID | 171369565 |
| Molecular Formula | C11H22ClN3O2 |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1C=NN.Cl |
| InChI | InChI=1S/C11H21N3O2.ClH/c1-11(2,3)16-10(15)14-7-5-4-6-9(14)8-13-12;/h8-9H,4-7,12H2,1-3H3;1H |
| InChIKey | CLPSWQPRUSWSJZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|