C14H26N2O3S — CID 121394190
tert-butyl (2R)-2-[(E)-[(R)-tert-butylsulfinyl]iminomethyl]pyrrolidine-1-carboxylate (PubChem CID 121394190) has the molecular formula C14H26N2O3S and a molecular weight of 302.44 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(E)-[(R)-tert-butylsulfinyl]iminomethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(E)-[(R)-tert-butylsulfinyl]iminomethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 121394190 |
| Molecular Formula | C14H26N2O3S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | tert-butyl (2R)-2-[(E)-[(R)-tert-butylsulfinyl]iminomethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1/C=N/[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C14H26N2O3S/c1-13(2,3)19-12(17)16-9-7-8-11(16)10-15-20(18)14(4,5)6/h10-11H,7-9H2,1-6H3/b15-10+/t11-,20-/m1/s1 |
| InChIKey | AAQKDLKIOANCTM-UGBJCPEASA-N |
| XLogP | 2.92 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|