C13H22N2O3S — CID 67262402
prop-1-en-2-yl (2S)-2-(tert-butylsulfinyliminomethyl)pyrrolidine-1-carboxylate (PubChem CID 67262402) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is prop-1-en-2-yl (2S)-2-(tert-butylsulfinyliminomethyl)pyrrolidine-1-carboxylate.
| Compound Name | prop-1-en-2-yl (2S)-2-(tert-butylsulfinyliminomethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67262402 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | prop-1-en-2-yl (2S)-2-(tert-butylsulfinyliminomethyl)pyrrolidine-1-carboxylate |
| SMILES | C=C(C)OC(=O)N1CCC[C@H]1C=NS(=O)C(C)(C)C |
| InChI | InChI=1S/C13H22N2O3S/c1-10(2)18-12(16)15-8-6-7-11(15)9-14-19(17)13(3,4)5/h9,11H,1,6-8H2,2-5H3/t11-,19?/m0/s1 |
| InChIKey | YOUVTSNLDFFCIO-IFGYVTRGSA-N |
| XLogP | 2.65 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|