C15H27N3O3 — CID 15460368
2-[(E)-[(2S)-1-(2,2-dimethylpropanoyl)pyrrolidin-2-yl]methylideneamino]oxy-N-propan-2-ylacetamide (PubChem CID 15460368) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-[(E)-[(2S)-1-(2,2-dimethylpropanoyl)pyrrolidin-2-yl]methylideneamino]oxy-N-propan-2-ylacetamide.
| Compound Name | 2-[(E)-[(2S)-1-(2,2-dimethylpropanoyl)pyrrolidin-2-yl]methylideneamino]oxy-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 15460368 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 2-[(E)-[(2S)-1-(2,2-dimethylpropanoyl)pyrrolidin-2-yl]methylideneamino]oxy-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CO/N=C/[C@@H]1CCCN1C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H27N3O3/c1-11(2)17-13(19)10-21-16-9-12-7-6-8-18(12)14(20)15(3,4)5/h9,11-12H,6-8,10H2,1-5H3,(H,17,19)/b16-9+/t12-/m0/s1 |
| InChIKey | UDOZDYWRHVTOHN-RGZVIEDOSA-N |
| XLogP | 1.55 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|