C15H25FN2O3 — CID 23237083
tert-butyl 2-[(E)-2-fluoro-3-oxo-3-(propan-2-ylamino)prop-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 23237083) has the molecular formula C15H25FN2O3 and a molecular weight of 300.37 g/mol. Its IUPAC name is tert-butyl 2-[(E)-2-fluoro-3-oxo-3-(propan-2-ylamino)prop-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(E)-2-fluoro-3-oxo-3-(propan-2-ylamino)prop-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 23237083 |
| Molecular Formula | C15H25FN2O3 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | tert-butyl 2-[(E)-2-fluoro-3-oxo-3-(propan-2-ylamino)prop-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)NC(=O)/C(F)=C\C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25FN2O3/c1-10(2)17-13(19)12(16)9-11-7-6-8-18(11)14(20)21-15(3,4)5/h9-11H,6-8H2,1-5H3,(H,17,19)/b12-9+ |
| InChIKey | BYAVWMODPDNNMN-FMIVXFBMSA-N |
| XLogP | 2.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|