C11H18ClNO2 — CID 150319571
tert-butyl 2-(2-chloroethenyl)pyrrolidine-1-carboxylate (PubChem CID 150319571) has the molecular formula C11H18ClNO2 and a molecular weight of 231.72 g/mol. Its IUPAC name is tert-butyl 2-(2-chloroethenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(2-chloroethenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 150319571 |
| Molecular Formula | C11H18ClNO2 |
| Molecular Weight | 231.72 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | tert-butyl 2-(2-chloroethenyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C=CCl |
| InChI | InChI=1S/C11H18ClNO2/c1-11(2,3)15-10(14)13-8-4-5-9(13)6-7-12/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | GNIKGMVIPDLVPS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.72 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |