C17H22ClNO2 — CID 76800293
tert-butyl 2-[2-(3-chlorophenyl)ethenyl]pyrrolidine-1-carboxylate (PubChem CID 76800293) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is tert-butyl 2-[2-(3-chlorophenyl)ethenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(3-chlorophenyl)ethenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 76800293 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | tert-butyl 2-[2-(3-chlorophenyl)ethenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C=Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H22ClNO2/c1-17(2,3)21-16(20)19-11-5-8-15(19)10-9-13-6-4-7-14(18)12-13/h4,6-7,9-10,12,15H,5,8,11H2,1-3H3 |
| InChIKey | YFLCVNGGUGWYEF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |