C18H24BrNO2 — CID 68765292
tert-butyl 2-[2-[4-(bromomethyl)phenyl]ethenyl]pyrrolidine-1-carboxylate (PubChem CID 68765292) has the molecular formula C18H24BrNO2 and a molecular weight of 366.30 g/mol. Its IUPAC name is tert-butyl 2-[2-[4-(bromomethyl)phenyl]ethenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[4-(bromomethyl)phenyl]ethenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 68765292 |
| Molecular Formula | C18H24BrNO2 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | tert-butyl 2-[2-[4-(bromomethyl)phenyl]ethenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C=Cc1ccc(CBr)cc1 |
| InChI | InChI=1S/C18H24BrNO2/c1-18(2,3)22-17(21)20-12-4-5-16(20)11-10-14-6-8-15(13-19)9-7-14/h6-11,16H,4-5,12-13H2,1-3H3 |
| InChIKey | FREFGVGFAIBGAE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|