C17H23NO4S — CID 10711993
tert-butyl (2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]pyrrolidine-1-carboxylate (PubChem CID 10711993) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10711993 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | tert-butyl (2S)-2-[(E)-2-(benzenesulfonyl)ethenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H23NO4S/c1-17(2,3)22-16(19)18-12-7-8-14(18)11-13-23(20,21)15-9-5-4-6-10-15/h4-6,9-11,13-14H,7-8,12H2,1-3H3/b13-11+/t14-/m0/s1 |
| InChIKey | RWFXJNBRONWHJA-CMPYXILNSA-N |
| XLogP | 3.37 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |