C19H27NO5S — CID 16744456
tert-butyl (2S)-2-[3-(benzenesulfonyl)-2-hydroxybut-3-enyl]pyrrolidine-1-carboxylate (PubChem CID 16744456) has the molecular formula C19H27NO5S and a molecular weight of 381.49 g/mol. Its IUPAC name is tert-butyl (2S)-2-[3-(benzenesulfonyl)-2-hydroxybut-3-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[3-(benzenesulfonyl)-2-hydroxybut-3-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 16744456 |
| Molecular Formula | C19H27NO5S |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | tert-butyl (2S)-2-[3-(benzenesulfonyl)-2-hydroxybut-3-enyl]pyrrolidine-1-carboxylate |
| SMILES | C=C(C(O)C[C@@H]1CCCN1C(=O)OC(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H27NO5S/c1-14(26(23,24)16-10-6-5-7-11-16)17(21)13-15-9-8-12-20(15)18(22)25-19(2,3)4/h5-7,10-11,15,17,21H,1,8-9,12-13H2,2-4H3/t15-,17?/m0/s1 |
| InChIKey | MKJWHARHMFLKDJ-MYJWUSKBSA-N |
| XLogP | 3.12 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |