C16H23NO2Se — CID 122386269
tert-butyl (2S)-2-(phenylselanylmethyl)pyrrolidine-1-carboxylate (PubChem CID 122386269) has the molecular formula C16H23NO2Se and a molecular weight of 340.32 g/mol. Its IUPAC name is tert-butyl (2S)-2-(phenylselanylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(phenylselanylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 122386269 |
| Molecular Formula | C16H23NO2Se |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | tert-butyl (2S)-2-(phenylselanylmethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C[Se]c1ccccc1 |
| InChI | InChI=1S/C16H23NO2Se/c1-16(2,3)19-15(18)17-11-7-8-13(17)12-20-14-9-5-4-6-10-14/h4-6,9-10,13H,7-8,11-12H2,1-3H3/t13-/m0/s1 |
| InChIKey | UXXUWYYKVFEOST-ZDUSSCGKSA-N |
| XLogP | 2.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|