C16H23NO3Se — CID 11035659
tert-butyl (2S,3R)-3-hydroxy-2-(phenylselanylmethyl)pyrrolidine-1-carboxylate (PubChem CID 11035659) has the molecular formula C16H23NO3Se and a molecular weight of 356.32 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-hydroxy-2-(phenylselanylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R)-3-hydroxy-2-(phenylselanylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11035659 |
| Molecular Formula | C16H23NO3Se |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | tert-butyl (2S,3R)-3-hydroxy-2-(phenylselanylmethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](O)[C@H]1C[Se]c1ccccc1 |
| InChI | InChI=1S/C16H23NO3Se/c1-16(2,3)20-15(19)17-10-9-14(18)13(17)11-21-12-7-5-4-6-8-12/h4-8,13-14,18H,9-11H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | PJBXEULWVWARLG-ZIAGYGMSSA-N |
| XLogP | 1.80 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|