C30H35NO2S — CID 164875537
tert-butyl 2-(2-tritylsulfanylethyl)pyrrolidine-1-carboxylate (PubChem CID 164875537) has the molecular formula C30H35NO2S and a molecular weight of 473.68 g/mol. Its IUPAC name is tert-butyl 2-(2-tritylsulfanylethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(2-tritylsulfanylethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 164875537 |
| Molecular Formula | C30H35NO2S |
| Molecular Weight | 473.68 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | tert-butyl 2-(2-tritylsulfanylethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1CCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H35NO2S/c1-29(2,3)33-28(32)31-22-13-20-27(31)21-23-34-30(24-14-7-4-8-15-24,25-16-9-5-10-17-25)26-18-11-6-12-19-26/h4-12,14-19,27H,13,20-23H2,1-3H3 |
| InChIKey | GRPXBPORNHREPM-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.68 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|