C22H31NO6S — CID 16744843
tert-butyl 2-[2-acetyloxy-3-(benzenesulfonyl)but-3-enyl]piperidine-1-carboxylate (PubChem CID 16744843) has the molecular formula C22H31NO6S and a molecular weight of 437.56 g/mol. Its IUPAC name is tert-butyl 2-[2-acetyloxy-3-(benzenesulfonyl)but-3-enyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-acetyloxy-3-(benzenesulfonyl)but-3-enyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 16744843 |
| Molecular Formula | C22H31NO6S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | tert-butyl 2-[2-acetyloxy-3-(benzenesulfonyl)but-3-enyl]piperidine-1-carboxylate |
| SMILES | C=C(C(CC1CCCCN1C(=O)OC(C)(C)C)OC(C)=O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H31NO6S/c1-16(30(26,27)19-12-7-6-8-13-19)20(28-17(2)24)15-18-11-9-10-14-23(18)21(25)29-22(3,4)5/h6-8,12-13,18,20H,1,9-11,14-15H2,2-5H3 |
| InChIKey | LTAHOOUDPXJVLR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |