C15H28N4O3 — CID 177428828
tert-butyl (2S)-2-[(E)-[methyl(propan-2-ylcarbamoyl)hydrazinylidene]methyl]pyrrolidine-1-carboxylate (PubChem CID 177428828) has the molecular formula C15H28N4O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(E)-[methyl(propan-2-ylcarbamoyl)hydrazinylidene]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(E)-[methyl(propan-2-ylcarbamoyl)hydrazinylidene]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 177428828 |
| Molecular Formula | C15H28N4O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | tert-butyl (2S)-2-[(E)-[methyl(propan-2-ylcarbamoyl)hydrazinylidene]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)NC(=O)N(C)/N=C/[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28N4O3/c1-11(2)17-13(20)18(6)16-10-12-8-7-9-19(12)14(21)22-15(3,4)5/h10-12H,7-9H2,1-6H3,(H,17,20)/b16-10+/t12-/m0/s1 |
| InChIKey | YMKGTVFQHXOEID-SEJMYLSOSA-N |
| XLogP | 2.42 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|