C17H29NO4 — CID 11722990
tert-butyl (2S)-2-[(E,3S)-3-methoxycarbonyl-4-methylpent-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 11722990) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(E,3S)-3-methoxycarbonyl-4-methylpent-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(E,3S)-3-methoxycarbonyl-4-methylpent-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11722990 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | tert-butyl (2S)-2-[(E,3S)-3-methoxycarbonyl-4-methylpent-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)[C@H](/C=C/[C@@H]1CCCN1C(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C17H29NO4/c1-12(2)14(15(19)21-6)10-9-13-8-7-11-18(13)16(20)22-17(3,4)5/h9-10,12-14H,7-8,11H2,1-6H3/b10-9+/t13-,14+/m0/s1 |
| InChIKey | JFQMEKVWSMGATD-XACNLCELSA-N |
| XLogP | 3.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|