C11H19F2NO4 — CID 145420609
tert-butyl 4,4-difluoro-2-methylpyrrolidine-1-carboxylate;formic acid (PubChem CID 145420609) has the molecular formula C11H19F2NO4 and a molecular weight of 267.27 g/mol. Its IUPAC name is tert-butyl 4,4-difluoro-2-methylpyrrolidine-1-carboxylate;formic acid.
| Compound Name | tert-butyl 4,4-difluoro-2-methylpyrrolidine-1-carboxylate;formic acid |
|---|---|
| PubChem CID | 145420609 |
| Molecular Formula | C11H19F2NO4 |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | tert-butyl 4,4-difluoro-2-methylpyrrolidine-1-carboxylate;formic acid |
| SMILES | CC1CC(F)(F)CN1C(=O)OC(C)(C)C.O=CO |
| InChI | InChI=1S/C10H17F2NO2.CH2O2/c1-7-5-10(11,12)6-13(7)8(14)15-9(2,3)4;2-1-3/h7H,5-6H2,1-4H3;1H,(H,2,3) |
| InChIKey | WMKFKWOIDIVCCJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|