C10H14F2N2O2 — CID 74349844
tert-butyl 2-cyano-4,4-difluoropyrrolidine-1-carboxylate (PubChem CID 74349844) has the molecular formula C10H14F2N2O2 and a molecular weight of 232.23 g/mol. Its IUPAC name is tert-butyl 2-cyano-4,4-difluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-cyano-4,4-difluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 74349844 |
| Molecular Formula | C10H14F2N2O2 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | tert-butyl 2-cyano-4,4-difluoropyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)(F)CC1C#N |
| InChI | InChI=1S/C10H14F2N2O2/c1-9(2,3)16-8(15)14-6-10(11,12)4-7(14)5-13/h7H,4,6H2,1-3H3 |
| InChIKey | NZUSVVISTGILKC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |