C12H20N2O3 — CID 155291753
tert-butyl 5-cyano-2,2-dimethylmorpholine-4-carboxylate (PubChem CID 155291753) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is tert-butyl 5-cyano-2,2-dimethylmorpholine-4-carboxylate.
| Compound Name | tert-butyl 5-cyano-2,2-dimethylmorpholine-4-carboxylate |
|---|---|
| PubChem CID | 155291753 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | tert-butyl 5-cyano-2,2-dimethylmorpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C)(C)OCC1C#N |
| InChI | InChI=1S/C12H20N2O3/c1-11(2,3)17-10(15)14-8-12(4,5)16-7-9(14)6-13/h9H,7-8H2,1-5H3 |
| InChIKey | RVRTZCIATMUVOK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |