C11H15F2NO2 — CID 163224641
tert-butyl (2R)-2-ethynyl-4,4-difluoropyrrolidine-1-carboxylate (PubChem CID 163224641) has the molecular formula C11H15F2NO2 and a molecular weight of 231.24 g/mol. Its IUPAC name is tert-butyl (2R)-2-ethynyl-4,4-difluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-ethynyl-4,4-difluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 163224641 |
| Molecular Formula | C11H15F2NO2 |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | tert-butyl (2R)-2-ethynyl-4,4-difluoropyrrolidine-1-carboxylate |
| SMILES | C#C[C@H]1CC(F)(F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H15F2NO2/c1-5-8-6-11(12,13)7-14(8)9(15)16-10(2,3)4/h1,8H,6-7H2,2-4H3/t8-/m0/s1 |
| InChIKey | RZPNXCDJCNVCHL-QMMMGPOBSA-N |
| XLogP | 2.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|