C12H19NO2 — CID 142989299
tert-butyl (2S,4R)-2-ethynyl-4-methylpyrrolidine-1-carboxylate (PubChem CID 142989299) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-ethynyl-4-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-ethynyl-4-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142989299 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | tert-butyl (2S,4R)-2-ethynyl-4-methylpyrrolidine-1-carboxylate |
| SMILES | C#C[C@@H]1C[C@@H](C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H19NO2/c1-6-10-7-9(2)8-13(10)11(14)15-12(3,4)5/h1,9-10H,7-8H2,2-5H3/t9-,10-/m1/s1 |
| InChIKey | JVICZEUOBSUPQO-NXEZZACHSA-N |
| XLogP | 2.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|