C14H23NO2 — CID 123267538
2,3-dimethylbutan-2-yl 2-ethynyl-4-methylpyrrolidine-1-carboxylate (PubChem CID 123267538) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl 2-ethynyl-4-methylpyrrolidine-1-carboxylate.
| Compound Name | 2,3-dimethylbutan-2-yl 2-ethynyl-4-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123267538 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 2,3-dimethylbutan-2-yl 2-ethynyl-4-methylpyrrolidine-1-carboxylate |
| SMILES | C#CC1CC(C)CN1C(=O)OC(C)(C)C(C)C |
| InChI | InChI=1S/C14H23NO2/c1-7-12-8-11(4)9-15(12)13(16)17-14(5,6)10(2)3/h1,10-12H,8-9H2,2-6H3 |
| InChIKey | WBHDTSBNZJHJEO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|