About ethane;1-(2-ethynyl-4,4-difluoropyrrolidin-1-yl)ethanone
ethane;1-(2-ethynyl-4,4-difluoropyrrolidin-1-yl)ethanone (PubChem CID 177014876) has the molecular formula C10H15F2NO
and a molecular weight of 203.23 g/mol. Its IUPAC name is ethane;1-(2-ethynyl-4,4-difluoropyrrolidin-1-yl)ethanone.
Molecular Properties
| Compound Name | ethane;1-(2-ethynyl-4,4-difluoropyrrolidin-1-yl)ethanone |
| PubChem CID | 177014876 |
| Molecular Formula | C10H15F2NO |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | ethane;1-(2-ethynyl-4,4-difluoropyrrolidin-1-yl)ethanone |
| SMILES | C#CC1CC(F)(F)CN1C(C)=O.CC |
| InChI | InChI=1S/C8H9F2NO.C2H6/c1-3-7-4-8(9,10)5-11(7)6(2)12;1-2/h1,7H,4-5H2,2H3;1-2H3 |
| InChIKey | ZSSITUCNUBOKGN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(2-ethynyl-4,4-difluoropyrrolidin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(2-ethynyl-4,4-difluoropyrrolidin-1-yl)ethanone?
The IUPAC name of ethane;1-(2-ethynyl-4,4-difluoropyrrolidin-1-yl)ethanone (CID 177014876) is ethane;1-(2-ethynyl-4,4-difluoropyrrolidin-1-yl)ethanone.
What is the SMILES notation for ethane;1-(2-ethynyl-4,4-difluoropyrrolidin-1-yl)ethanone?
The canonical SMILES for ethane;1-(2-ethynyl-4,4-difluoropyrrolidin-1-yl)ethanone is C#CC1CC(F)(F)CN1C(C)=O.CC.
What is the InChIKey of ethane;1-(2-ethynyl-4,4-difluoropyrrolidin-1-yl)ethanone?
The InChIKey is ZSSITUCNUBOKGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2NO.C2H6/c1-3-7-4-8(9,10)5-11(7)6(2)12;1-2/h1,7H,4-5H2,2H3;1-2H3.
What are the key properties of ethane;1-(2-ethynyl-4,4-difluoropyrrolidin-1-yl)ethanone?
ethane;1-(2-ethynyl-4,4-difluoropyrrolidin-1-yl)ethanone has a molecular weight of 203.23 g/mol, XLogP of 1.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(2-ethynyl-4,4-difluoropyrrolidin-1-yl)ethanone is sourced from PubChem (CID 177014876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).