C10H15F2N — CID 157285289
(2S)-1-tert-butyl-2-ethynyl-4,4-difluoropyrrolidine (PubChem CID 157285289) has the molecular formula C10H15F2N and a molecular weight of 187.23 g/mol. Its IUPAC name is (2S)-1-tert-butyl-2-ethynyl-4,4-difluoropyrrolidine.
| Compound Name | (2S)-1-tert-butyl-2-ethynyl-4,4-difluoropyrrolidine |
|---|---|
| PubChem CID | 157285289 |
| Molecular Formula | C10H15F2N |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (2S)-1-tert-butyl-2-ethynyl-4,4-difluoropyrrolidine |
| SMILES | C#C[C@@H]1CC(F)(F)CN1C(C)(C)C |
| InChI | InChI=1S/C10H15F2N/c1-5-8-6-10(11,12)7-13(8)9(2,3)4/h1,8H,6-7H2,2-4H3/t8-/m1/s1 |
| InChIKey | BADUFWYOAJSYAE-MRVPVSSYSA-N |
| XLogP | 2.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|