C14H25F2NO2 — CID 168743098
tert-butyl 2-tert-butyl-5,5-difluoropiperidine-1-carboxylate (PubChem CID 168743098) has the molecular formula C14H25F2NO2 and a molecular weight of 277.35 g/mol. Its IUPAC name is tert-butyl 2-tert-butyl-5,5-difluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-tert-butyl-5,5-difluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 168743098 |
| Molecular Formula | C14H25F2NO2 |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | tert-butyl 2-tert-butyl-5,5-difluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)(F)CCC1C(C)(C)C |
| InChI | InChI=1S/C14H25F2NO2/c1-12(2,3)10-7-8-14(15,16)9-17(10)11(18)19-13(4,5)6/h10H,7-9H2,1-6H3 |
| InChIKey | ZJHWAYHUUYIJJL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |