C9H15F2NO2 — CID 18542424
tert-butyl 3,3-difluoropyrrolidine-1-carboxylate (PubChem CID 18542424) has the molecular formula C9H15F2NO2 and a molecular weight of 207.22 g/mol. Its IUPAC name is tert-butyl 3,3-difluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3,3-difluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 18542424 |
| Molecular Formula | C9H15F2NO2 |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | tert-butyl 3,3-difluoropyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C9H15F2NO2/c1-8(2,3)14-7(13)12-5-4-9(10,11)6-12/h4-6H2,1-3H3 |
| InChIKey | ULFWNKDACVUZOD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |