C13H21F2NO4 — CID 143752106
acetylene;tert-butyl 3,3-difluoropyrrolidine-1-carboxylate;methyl formate (PubChem CID 143752106) has the molecular formula C13H21F2NO4 and a molecular weight of 293.31 g/mol. Its IUPAC name is acetylene;tert-butyl 3,3-difluoropyrrolidine-1-carboxylate;methyl formate.
| Compound Name | acetylene;tert-butyl 3,3-difluoropyrrolidine-1-carboxylate;methyl formate |
|---|---|
| PubChem CID | 143752106 |
| Molecular Formula | C13H21F2NO4 |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | acetylene;tert-butyl 3,3-difluoropyrrolidine-1-carboxylate;methyl formate |
| SMILES | C#C.CC(C)(C)OC(=O)N1CCC(F)(F)C1.COC=O |
| InChI | InChI=1S/C9H15F2NO2.C2H4O2.C2H2/c1-8(2,3)14-7(13)12-5-4-9(10,11)6-12;1-4-2-3;1-2/h4-6H2,1-3H3;2H,1H3;1-2H |
| InChIKey | KLANRPKACLSPHD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|