C11H18N2O3 — CID 155290931
tert-butyl (2R,5S)-2-cyano-5-methylmorpholine-4-carboxylate (PubChem CID 155290931) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is tert-butyl (2R,5S)-2-cyano-5-methylmorpholine-4-carboxylate.
| Compound Name | tert-butyl (2R,5S)-2-cyano-5-methylmorpholine-4-carboxylate |
|---|---|
| PubChem CID | 155290931 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | tert-butyl (2R,5S)-2-cyano-5-methylmorpholine-4-carboxylate |
| SMILES | C[C@H]1CO[C@@H](C#N)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H18N2O3/c1-8-7-15-9(5-12)6-13(8)10(14)16-11(2,3)4/h8-9H,6-7H2,1-4H3/t8-,9-/m0/s1 |
| InChIKey | JRPFZNVTKVFVBV-IUCAKERBSA-N |
| XLogP | 1.53 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |