C10H19NO2 — CID 174284070
tert-butyl (3R)-2,3-dimethylazetidine-1-carboxylate (PubChem CID 174284070) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is tert-butyl (3R)-2,3-dimethylazetidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-2,3-dimethylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 174284070 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | tert-butyl (3R)-2,3-dimethylazetidine-1-carboxylate |
| SMILES | CC1[C@H](C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19NO2/c1-7-6-11(8(7)2)9(12)13-10(3,4)5/h7-8H,6H2,1-5H3/t7-,8?/m1/s1 |
| InChIKey | VSHDUCPSOQXOLE-GVHYBUMESA-N |
| XLogP | 2.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |