C12H23NO4 — CID 178026408
ethane;2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid (PubChem CID 178026408) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is ethane;2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid.
| Compound Name | ethane;2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 178026408 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | ethane;2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid |
| SMILES | CC.CC1C(C(=O)O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H17NO4.C2H6/c1-6-7(8(12)13)5-11(6)9(14)15-10(2,3)4;1-2/h6-7H,5H2,1-4H3,(H,12,13);1-2H3 |
| InChIKey | GCCSEGNXHMYIBH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |