C9H18N2O2 — CID 135397248
tert-butyl (2S)-3-amino-2-methylazetidine-1-carboxylate (PubChem CID 135397248) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is tert-butyl (2S)-3-amino-2-methylazetidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-3-amino-2-methylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 135397248 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | tert-butyl (2S)-3-amino-2-methylazetidine-1-carboxylate |
| SMILES | C[C@H]1C(N)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H18N2O2/c1-6-7(10)5-11(6)8(12)13-9(2,3)4/h6-7H,5,10H2,1-4H3/t6-,7?/m0/s1 |
| InChIKey | KMNTYEYDNBONGP-PKPIPKONSA-N |
| XLogP | 0.95 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |