C11H21NO4S — CID 175568283
tert-butyl 2-methyl-3-(methylsulfonylmethyl)azetidine-1-carboxylate (PubChem CID 175568283) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is tert-butyl 2-methyl-3-(methylsulfonylmethyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 2-methyl-3-(methylsulfonylmethyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 175568283 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | tert-butyl 2-methyl-3-(methylsulfonylmethyl)azetidine-1-carboxylate |
| SMILES | CC1C(CS(C)(=O)=O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21NO4S/c1-8-9(7-17(5,14)15)6-12(8)10(13)16-11(2,3)4/h8-9H,6-7H2,1-5H3 |
| InChIKey | FGWMWMYVTVRFEH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |