C11H21ClN2O2 — CID 86683704
tert-butyl (2R,5S)-4-chloro-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 86683704) has the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. Its IUPAC name is tert-butyl (2R,5S)-4-chloro-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,5S)-4-chloro-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 86683704 |
| Molecular Formula | C11H21ClN2O2 |
| Molecular Weight | 248.75 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | tert-butyl (2R,5S)-4-chloro-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(Cl)[C@@H](C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21ClN2O2/c1-8-7-14(12)9(2)6-13(8)10(15)16-11(3,4)5/h8-9H,6-7H2,1-5H3/t8-,9+/m1/s1 |
| InChIKey | LGVOXOICBXYCRT-BDAKNGLRSA-N |
| XLogP | 2.47 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.75 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|