C19H30N2O4S — CID 169115223
ditert-butyl (2R,5S)-2-methyl-5-thiophen-3-ylpiperazine-1,4-dicarboxylate (PubChem CID 169115223) has the molecular formula C19H30N2O4S and a molecular weight of 382.53 g/mol. Its IUPAC name is ditert-butyl (2R,5S)-2-methyl-5-thiophen-3-ylpiperazine-1,4-dicarboxylate.
| Compound Name | ditert-butyl (2R,5S)-2-methyl-5-thiophen-3-ylpiperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 169115223 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | ditert-butyl (2R,5S)-2-methyl-5-thiophen-3-ylpiperazine-1,4-dicarboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)[C@@H](c2ccsc2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30N2O4S/c1-13-10-21(17(23)25-19(5,6)7)15(14-8-9-26-12-14)11-20(13)16(22)24-18(2,3)4/h8-9,12-13,15H,10-11H2,1-7H3/t13-,15-/m1/s1 |
| InChIKey | XSWYZXVOEUFCOD-UKRRQHHQSA-N |
| XLogP | 4.67 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |