C14H27ClN2O2 — CID 89173836
tert-butyl (2S)-4-(3-chloropropyl)-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 89173836) has the molecular formula C14H27ClN2O2 and a molecular weight of 290.83 g/mol. Its IUPAC name is tert-butyl (2S)-4-(3-chloropropyl)-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-(3-chloropropyl)-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 89173836 |
| Molecular Formula | C14H27ClN2O2 |
| Molecular Weight | 290.83 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | tert-butyl (2S)-4-(3-chloropropyl)-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)[C@@H](C)CN1CCCCl |
| InChI | InChI=1S/C14H27ClN2O2/c1-11-10-17(13(18)19-14(3,4)5)12(2)9-16(11)8-6-7-15/h11-12H,6-10H2,1-5H3/t11?,12-/m0/s1 |
| InChIKey | RZWNWHWOHQPPGT-KIYNQFGBSA-N |
| XLogP | 2.94 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.83 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|