C18H26N2O3 — CID 86724020
tert-butyl (2R,5R)-4-benzyl-5-formyl-2-methylpiperazine-1-carboxylate (PubChem CID 86724020) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is tert-butyl (2R,5R)-4-benzyl-5-formyl-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,5R)-4-benzyl-5-formyl-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 86724020 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | tert-butyl (2R,5R)-4-benzyl-5-formyl-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(Cc2ccccc2)[C@@H](C=O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26N2O3/c1-14-10-19(11-15-8-6-5-7-9-15)16(13-21)12-20(14)17(22)23-18(2,3)4/h5-9,13-14,16H,10-12H2,1-4H3/t14-,16-/m1/s1 |
| InChIKey | RJYNFBHQBQNBHS-GDBMZVCRSA-N |
| XLogP | 2.70 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|