C24H28F2N2O3 — CID 170445631
tert-butyl (2S,5S)-4-[bis(4-fluorophenyl)methyl]-5-formyl-2-methylpiperazine-1-carboxylate (PubChem CID 170445631) has the molecular formula C24H28F2N2O3 and a molecular weight of 430.50 g/mol. Its IUPAC name is tert-butyl (2S,5S)-4-[bis(4-fluorophenyl)methyl]-5-formyl-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S,5S)-4-[bis(4-fluorophenyl)methyl]-5-formyl-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 170445631 |
| Molecular Formula | C24H28F2N2O3 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | tert-butyl (2S,5S)-4-[bis(4-fluorophenyl)methyl]-5-formyl-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@H]1CN(C(c2ccc(F)cc2)c2ccc(F)cc2)[C@H](C=O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H28F2N2O3/c1-16-13-28(21(15-29)14-27(16)23(30)31-24(2,3)4)22(17-5-9-19(25)10-6-17)18-7-11-20(26)12-8-18/h5-12,15-16,21-22H,13-14H2,1-4H3/t16-,21-/m0/s1 |
| InChIKey | ABXJQVCLIFJPJA-KKSFZXQISA-N |
| XLogP | 4.56 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|