C24H30F2N2O2 — CID 175111260
tert-butyl 4-[bis(4-fluorophenyl)methyl]-3-ethylpiperazine-1-carboxylate (PubChem CID 175111260) has the molecular formula C24H30F2N2O2 and a molecular weight of 416.51 g/mol. Its IUPAC name is tert-butyl 4-[bis(4-fluorophenyl)methyl]-3-ethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[bis(4-fluorophenyl)methyl]-3-ethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 175111260 |
| Molecular Formula | C24H30F2N2O2 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | tert-butyl 4-[bis(4-fluorophenyl)methyl]-3-ethylpiperazine-1-carboxylate |
| SMILES | CCC1CN(C(=O)OC(C)(C)C)CCN1C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H30F2N2O2/c1-5-21-16-27(23(29)30-24(2,3)4)14-15-28(21)22(17-6-10-19(25)11-7-17)18-8-12-20(26)13-9-18/h6-13,21-22H,5,14-16H2,1-4H3 |
| InChIKey | KEAXGVSIDSRSMF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |