C25H33N3O3 — CID 178079649
tert-butyl (3S)-4-benzhydryl-3-[2-(methylamino)-2-oxoethyl]piperazine-1-carboxylate (PubChem CID 178079649) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is tert-butyl (3S)-4-benzhydryl-3-[2-(methylamino)-2-oxoethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-benzhydryl-3-[2-(methylamino)-2-oxoethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 178079649 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | tert-butyl (3S)-4-benzhydryl-3-[2-(methylamino)-2-oxoethyl]piperazine-1-carboxylate |
| SMILES | CNC(=O)C[C@H]1CN(C(=O)OC(C)(C)C)CCN1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H33N3O3/c1-25(2,3)31-24(30)27-15-16-28(21(18-27)17-22(29)26-4)23(19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,21,23H,15-18H2,1-4H3,(H,26,29)/t21-/m0/s1 |
| InChIKey | HLXHPJZEKCBSGP-NRFANRHFSA-N |
| XLogP | 3.83 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |